BindingDB logo
myBDB logout

7 SMILES Strings for Lignostilbene alpha, beta-dioxygenase

Compound NameSMILES String
BDBM50111617 C\C(=C\c1ccc(O)cc1)c1ccccc1
BDBM50111618 CC(=C)c1ccc(O)cc1
BDBM50111619 C\C(=C\c1ccccc1)c1ccccc1
BDBM50111620 Oc1ccc(cc1)C(\F)=C\c1ccccc1
BDBM50111621 C\C(=C/c1ccc(O)cc1)c1ccccc1
BDBM50111622 C\C(=C/c1ccccc1)c1ccccc1
BDBM50111623 F\C(=C/c1ccccc1)c1ccccc1