BindingDB logo
myBDB logout

12 SMILES Strings for Lipoxygenase (LOX)

Compound NameSMILES String
BDBM29532 COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(O)c(OC)c2)ccc1O |w:5.4,13.13|
BDBM111805 CNC(CO)c1ccc(\C=C2/CCC\C(=C/c3ccc(cc3)C(CO)NC)C2=O)cc1
BDBM111807 COc1cccc(\C=C2/CCC\C(=C/c3cccc(OC)c3OC)C2=O)c1OC
BDBM111809 CCN(CC)C(C#C)c1ccc(\C=C2/CCC\C(=C/c3ccc(cc3C)C(C#C)N(CC)CC)C2=O)c(C)c1
BDBM111810 CNC(CO)c1ccc(\C=C\C(=O)\C=C\c2ccc(cc2)C(CO)NC)cc1
BDBM111811 COc1cccc(\C=C\C(=O)\C=C\c2cccc(OC)c2OC)c1OC
BDBM111812 CCN(CC)c1ccc(\C=C\C(=O)\C=C\c2ccc(cc2)N(CC)CC)cc1
BDBM111813 CCN(CC)C(C#N)c1ccc(\C=C\C(=O)\C=C\c2ccc(cc2C)C(C#N)N(CC)CC)c(C)c1
BDBM111814 CNC(CO)c1ccc(\C=C2/CC\C(=C/c3ccc(cc3)C(CO)NC)C2=O)cc1
BDBM111816 COc1cccc(\C=C2/CC\C(=C/c3cccc(OC)c3OC)C2=O)c1OC
BDBM111817 CCN(CC)c1ccc(\C=C2/CC\C(=C/c3ccc(cc3)N(CC)CC)C2=O)cc1
BDBM32020 CC(Cc1ccc(O)c(O)c1)C(C)Cc1ccc(O)c(O)c1