BindingDB logo
myBDB logout

11 SMILES Strings for Lipoxygenase (SLO)

Compound NameSMILES String
BDBM32020 CC(Cc1ccc(O)c(O)c1)C(C)Cc1ccc(O)c(O)c1
BDBM222277 COC(=O)c1c(C)oc(c1CC(=O)c1ccc(C)c(Cl)c1)-c1ccc(C)c(Cl)c1
BDBM222268 COC(=O)c1c(C)oc(c1CC(=O)c1ccccc1)-c1ccccc1
BDBM222270 COC(=O)c1c(C)oc(c1CC(=O)c1ccc(C)cc1)-c1ccc(C)cc1
BDBM222269 CCOC(=O)c1c(C)oc(c1CC(=O)c1ccccc1)-c1ccccc1
BDBM222271 CCOC(=O)c1c(C)oc(c1CC(=O)c1ccc(C)cc1)-c1ccc(C)cc1
BDBM222272 COC(=O)c1c(C)oc(c1CC(=O)c1ccc(Br)cc1)-c1ccc(Br)cc1
BDBM222273 CCOC(=O)c1c(C)oc(c1CC(=O)c1ccc(Br)cc1)-c1ccc(Br)cc1
BDBM222274 COC(=O)c1c(C)oc(c1CC(=O)c1ccc(Cl)cc1)-c1ccc(Cl)cc1
BDBM222275 CCOC(=O)c1c(C)oc(c1CC(=O)c1ccc(Cl)cc1)-c1ccc(Cl)cc1
BDBM222276 CCOC(=O)c1c(C)oc(c1CC(=O)c1ccc(C)c(Cl)c1)-c1ccc(C)c(Cl)c1