BindingDB logo
myBDB logout

5 SMILES Strings for Liver X receptor

Compound NameSMILES String
BDBM19993 OC(c1ccc(cc1)N(CC(F)(F)F)S(=O)(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F
BDBM28802 COC(=O)N(CC(O)=O)Cc1cc(OCc2nc(oc2C)-c2ccc(Cl)cc2)ccc1F
BDBM50396601 CN1c2ccc(O)cc2C(=C)c2ccccc2C1=O
BDBM50122619 COc1ccc(\C=C\c2ccccc2N2C(=O)c3ccccc3C2=O)cc1OC
BDBM50177015 CC(C)[C@@H]1CN(CCN1c1ncc(CO)c(n1)C(F)(F)F)c1ccc(CO)c(c1)S(C)(=O)=O |r|