BindingDB logo
myBDB logout

21 SMILES Strings for Liver fatty acid binding protein (FABP1)

Compound NameSMILES String
BDBM21278 Cc1c(nn(c1-c1ccc(Cl)cc1)-c1ccc(Cl)cc1Cl)C(=O)NN1CCCCC1
BDBM22988 CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)NCCO
BDBM26144 CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)OC(CO)CO
BDBM29080 CCCCCCCC\C=C/CCCCCCCC(=O)NCCO
BDBM50121429 [H][C@]1(C=C(C)CC[C@H]1C(C)=C)c1c(O)cc(CCCCC)cc1O |r,t:2|
BDBM50054471 CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)Nc1ccc(O)cc1
BDBM50067499 CCCCCCC(C)(C)c1cc(O)c2[C@@H]3CC(CO)=CC[C@H]3C(C)(C)Oc2c1 |r,c:18|
BDBM50072775 CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CCCO)c(O)c1 |r|
BDBM50212873 CCc1c(c(nn1-c1ccccc1-c1cccc(OCC(O)=O)c1)-c1ccccc1)-c1ccccc1
BDBM50353747 CCCCCn1cc(C(=O)c2cccc3ccccc23)c2ccccc12
BDBM50048066 CCCCCCCC\C=C/CCCCCCCC(=O)N[C@@H](CO)Cc1ccc(O)cc1
BDBM197163 CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCO
BDBM197164 CCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCC(=O)NCCO
BDBM197165 CCCCCCCC\C=C/CCCCCCCC(=O)OC(CO)CO
BDBM197166 CCCCCCCCCCCCCCCC(=O)OC(CO)CO
BDBM197167 CCCCCC=CCC=CCC=CCC=CCCCC(=O)Nc1ccc(O)cc1C
BDBM197168 CCCCCCCC\C=C/CCCCCCCC(=O)N[C@H](CO)Cc1ccc(O)cc1
BDBM197169 CC(=O)Nc1ccc(Nc2nc(cs2)-c2ccc(Cl)c(Cl)c2)cc1
BDBM197170 COc1cc(cc2ON=C(Nc12)c1ccc(Br)cc1)[N+]([O-])=O |c:8|
BDBM197171 CC(C)CC(=O)N1c2ccc(C)cc2-c2c(ssc2=S)C1(C)C
BDBM60994 CCCCCc1cc(O)c2[C@@H]3C=C(C)CC[C@H]3C(C)(C)Oc2c1 |r,t:11|