BindingDB logo
myBDB logout

3 SMILES Strings for Liver fatty acid binding protein (human L-FABP T94A)

Compound NameSMILES String
BDBM28700 CC(C)(Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1)C(O)=O
BDBM119875 CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O)=O
BDBM50085042 CC(C)OC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1