BindingDB logo
myBDB logout

6 SMILES Strings for Liver fatty acid binding protein (human L-FABP T94T)

Compound NameSMILES String
BDBM28700 CC(C)(Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1)C(O)=O
BDBM119875 CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O)=O
BDBM50085042 CC(C)OC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1
BDBM50150484 CCCCCCCC\C=C/CCCCCCCC(O)=O
BDBM50243721 OS(=O)(=O)Oc1cccc2cccc(Nc3ccccc3)c12
BDBM50310988 COC(=O)c1sc(cc1NC(=O)\C=C\C(O)=O)-c1cccs1