BindingDB logo
myBDB logout

22 SMILES Strings for Liver fatty acid binding protein (rat L-FABP)

Compound NameSMILES String
BDBM8903 [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |r,t:20|
BDBM13066 OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl
BDBM19190 [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |r,c:27,t:23|
BDBM18207 [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |c:28,t:24|
BDBM22971 Cc1ccc(Cl)c(Nc2ccccc2C(O)=O)c1Cl
BDBM22360 CC(=O)Oc1ccccc1C(O)=O
BDBM25753 CC(C)NCC(O)COc1ccc(CC(N)=O)cc1
BDBM25766 CC(C)(C)NCC(O)COc1cccc2C[C@@H](O)[C@@H](O)Cc12
BDBM28700 CC(C)(Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1)C(O)=O
BDBM28701 CC(C)(Oc1ccc(CCNC(=O)c2ccc(Cl)cc2)cc1)C(O)=O
BDBM85511 OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1
BDBM119875 CC(C)CCCC(C)CCCC(C)CCCC(C)CC(O)=O
BDBM50000766 CN1c2ccc(Cl)cc2C(=NCC1=O)c1ccccc1 |c:10|
BDBM50009859 CC(C)Cc1ccc(cc1)C(C)C(O)=O
BDBM50074922 CC(C(O)=O)c1ccc(c(F)c1)-c1ccccc1
BDBM50085042 CC(C)OC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1
BDBM50085047 CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1
BDBM50110590 Cc1ccc(C)c(OCCCC(C)(C)C(O)=O)c1
BDBM50150484 CCCCCCCC\C=C/CCCCCCCC(O)=O
BDBM50233673 CC(C(O)=O)c1ccc(cc1)N1Cc2ccccc2C1=O
BDBM50243721 OS(=O)(=O)Oc1cccc2cccc(Nc3ccccc3)c12
BDBM50292627 OC1N=C(c2ccccc2Cl)c2cc(Cl)ccc2NC1=O |t:2|