BindingDB logo
myBDB logout

27 SMILES Strings for Liver glycogen phosphorylase

Compound NameSMILES String
BDBM10849 Cn1cnc2n(C)c(=O)n(C)c(=O)c12
BDBM34110 OC[C@H]1O[C@@]2(CC(=NO2)c2ccc3ccccc3c2)[C@H](O)[C@@H](O)[C@@H]1O |c:6|
BDBM50065965 CN(C)C(=O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc2cc(Cl)ccc2[nH]1
BDBM50135549 OC(=O)c1ccc(Oc2cccc(F)c2NC(=O)c2cccc(c2)[N+]([O-])=O)cc1C(O)=O
BDBM50135550 OC(=O)c1ccc(Oc2cccc(F)c2NC(=O)c2cc(Cl)ccn2)cc1C(O)=O
BDBM50135552 OC(=O)c1ccc(Oc2ccccc2NC(=O)c2cc(Cl)ccn2)cc1C(O)=O
BDBM50135556 COc1ccnc(c1)C(=O)Nc1ccccc1Oc1ccc(C(O)=O)c(c1)C(O)=O
BDBM50135563 OC(=O)c1ccc(Oc2ccccc2NC(=O)c2cc(ccn2)C#N)cc1C(O)=O
BDBM50149207 Clc1ccc2[nH]c(cc2c1)C(=O)NCCOCCOCCNC(=O)c1cc2cc(Cl)ccc2[nH]1
BDBM50149237 COCCNC(=O)c1cc2cc(Cl)ccc2[nH]1
BDBM50175892 CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O |r,c:10|
BDBM50182801 OC[C@H]1CNC[C@@H](O)[C@@H]1O |r|
BDBM50194701 OC[C@H]1[NH2+]C[C@@H](O)[C@@H]1O
BDBM50194702 OC[C@H]1CN(CCCc2ccccc2)C[C@@H](O)[C@@H]1O
BDBM50211294 OC[C@H]1OC2(NC(=S)NC2=O)[C@H](O)[C@@H](O)[C@@H]1O
BDBM50222205 C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2[C@H]1C)C(O)=O |r,c:9|
BDBM50263769 OC[C@H]1O[C@@]2(NC(=S)NC2=O)[C@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50294476 OC[C@H]1O[C@@H](CC(=O)C=Cc2ccc3ccccc3c2)[C@H](O)[C@@H](O)[C@@H]1O |r,w:8.7|
BDBM50146081 OC[C@H]1O[C@@]2(CC(=NO2)c2cc3ccccc3c3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |r,c:6|
BDBM50146090 OC[C@H]1O[C@@]2(CC(=NO2)c2ccc3OCCOc3c2)[C@H](O)[C@@H](O)[C@@H]1O |r,c:6|
BDBM50146082 OC[C@H]1O[C@@]2(CC(=NO2)c2ccc3cc(O)ccc3c2)[C@H](O)[C@@H](O)[C@@H]1O |r,c:6|
BDBM50146085 COc1cc(OC)cc(c1)C1=NO[C@@]2(C1)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |r,t:11|
BDBM50146086 CSc1ccc(cc1)C1=NO[C@@]2(C1)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |r,t:9|
BDBM50146088 OC[C@H]1O[C@@]2(CC(=NO2)c2ccc3OCOc3c2)[C@H](O)[C@@H](O)[C@@H]1O |r,c:6|
BDBM50146091 CC(=O)OC[C@H]1O[C@@]2(CC(=NO2)c2ccc3ccccc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |r,c:9|
BDBM50215446 OC[C@@H]1O[C@@]2(NC(=O)NC2=O)[C@@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50016703 OC[C@H]1NC[C@@H](O)[C@@H]1O |r|