BindingDB logo
myBDB logout

9 SMILES Strings for LmbE-related protein

Compound NameSMILES String
BDBM50227091 OC[C@@H]1O[C@@H](SC2CCCCC2)[C@@H](NC(=O)C2CCOC(=N2)c2cccc(F)c2)[C@H](O)[C@H]1O |w:16.16,c:21|
BDBM50227092 OC[C@@H]1O[C@@H](SC2CCCCC2)[C@@H](NC(=O)c2ccc(o2)-c2ccc(Cl)cc2)[C@H](O)[C@H]1O
BDBM50227093 OC[C@@H]1O[C@@H](SC2CCCCC2)[C@@H](NS(=O)(=O)CCCCc2ccccc2)[C@H](O)[C@H]1O
BDBM50227094 OC[C@@H]1O[C@@H](SC2CCCCC2)[C@@H](NC(=O)C2COC(=N2)c2cccc(F)c2)[C@H](O)[C@H]1O |w:16.16,c:20|
BDBM50227095 CC(C)(C)C(=O)ON[C@@H](CCc1ccccc1)C(=O)N[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1SC1CCCCC1
BDBM50227096 OC[C@@H]1O[C@@H](SC2CCCCC2)[C@@H](NS(=O)(=O)\C=C\CCc2ccccc2)[C@H](O)[C@H]1O
BDBM50315605 Cc1c(O)c2cccc(O)c2c(O)c1C=CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1Sc1ccccc1 |r,w:15.17|
BDBM50315606 Cc1c(O)c2cccc(O)c2c(O)c1C=CCCC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1Sc1ccccc1 |r,w:15.17|
BDBM50315607 Cc1c(O)c2cccc(O)c2c(O)c1C=CCCCC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1Sc1ccccc1 |r,w:15.17|