BindingDB logo
myBDB logout

1 SMILES String for Low affinity immunoglobulin gamma Fc region receptor II-a

Compound NameSMILES String
BDBM50303805 Nc1ccc(CCNc2nc(Nc3ccc(CCNc4nc(NCCO)nc(Nc5cccc(N)c5)n4)cc3)nc(Nc3cccc(N)c3)n2)cc1