BindingDB logo
myBDB logout

8 SMILES Strings for Low affinity neurotrophin receptor p75NTR

Compound NameSMILES String
BDBM50029494 COC(=O)c1c(C)sc2c(O)cc(nc12)C(O)=O
BDBM50029495 Cn1c2cc(nn2c(=O)c2cc(NC(=O)c3ccccc3)ccc12)C(O)=O
BDBM50029496 Nc1ccc2nc(cc(O)c2c1)C(O)=O
BDBM50029497 COC(=O)c1c(C)sc2c(O)cc(nc12)C(=O)Nn1cnnn1
BDBM50111443 OCCNN1C(=O)c2cccc3cc(cc(C1=O)c23)[N+]([O-])=O
BDBM50180054 COc1ccc2cccc(N3CCN(CCCCn4ncc(=O)n(C)c4=O)CC3)c2c1
BDBM50182020 COc1cccc(c1)N1CCN(CCCCn2ncc(=O)n(C)c2=O)CC1
BDBM50396070 Cc1cc2nc3c(nc(=O)[nH]c3=O)n(C)c2cc1C=O