BindingDB logo
myBDB logout

41 SMILES Strings for Low molecular weight phosphotyrosine protein phosphatase

Compound NameSMILES String
BDBM26658 Oc1ccc(c(O)c1)-c1oc2cc(O)cc(O)c2c(=O)c1O
BDBM38435 CCn1c2c(CCCC2=O)c2cc(ccc12)C(O)=O
BDBM50214527 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3ccc(OCc4ccccc4)cc3)C2=O)cc1
BDBM50214528 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3ccc(O)cc3)C2=O)cc1
BDBM50214529 COc1cc(\C=C2/SC(=O)N(Cc3ccc(cc3)C(O)=O)C2=O)ccc1O
BDBM50214530 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3ccc(Oc4ccccc4)cc3)C2=O)cc1
BDBM50214531 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3cccc(Oc4ccccc4)c3)C2=O)cc1
BDBM50214532 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3ccc4ccccc4c3)C2=O)cc1
BDBM50214533 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3cccc(O)c3)C2=O)cc1
BDBM50214534 OC(=O)COc1ccc(\C=C2/SC(=O)N(Cc3ccc(cc3)C(O)=O)C2=O)cc1
BDBM50214535 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3cccc4ccccc34)C2=O)cc1
BDBM50214536 OC(=O)c1ccc(CN2C(=O)S\C(=C/c3cccc(OCc4ccccc4)c3)C2=O)cc1
BDBM50267068 OC(=O)c1ccc(CN2\C(S\C(=C/c3cccc(Oc4ccccc4)c3)C2=O)=N\c2ccccc2)cc1
BDBM50267069 OC(=O)c1ccc(CN2\C(S\C(=C/c3ccc(Oc4ccccc4)cc3)C2=O)=N\c2ccccc2)cc1
BDBM50267070 OC(=O)c1ccc(CN2\C(S\C(=C/c3cccc(OCc4ccccc4)c3)C2=O)=N\c2ccccc2)cc1
BDBM50267140 OC(=O)c1ccc(CN2\C(S\C(=C/c3ccc(O)cc3)C2=O)=N\c2ccccc2)cc1
BDBM50267141 COc1ccc(\C=C2/S\C(=N/c3ccccc3)N(Cc3ccc(cc3)C(O)=O)C2=O)cc1O
BDBM50267142 COc1cc(\C=C2/S\C(=N/c3ccccc3)N(Cc3ccc(cc3)C(O)=O)C2=O)ccc1O
BDBM50267143 OC(=O)c1ccc(CN2\C(S\C(=C/c3ccc(O)c(c3)C(O)=O)C2=O)=N\c2ccccc2)cc1
BDBM50267098 OC(=O)c1ccc(CN2\C(S\C(=C/c3ccc(OCc4ccccc4)cc3)C2=O)=N\c2ccccc2)cc1
BDBM50267099 OC(=O)c1ccc(CN2\C(S\C(=C/c3cccc4ccccc34)C2=O)=N\c2ccccc2)cc1
BDBM50267100 OC(=O)c1ccc(CN2\C(S\C(=C/c3ccc4ccccc4c3)C2=O)=N\c2ccccc2)cc1
BDBM50267101 OC(=O)c1ccc(CN2\C(S\C(=C/c3cccc(O)c3)C2=O)=N\c2ccccc2)cc1
BDBM50371116 Cn1c2ccc(cc2oc1=O)S(=O)(=O)N1CCC(CC1)C(O)=O
BDBM50371117 OC(=O)CCC(=O)N1N=C(CC1c1ccccc1F)c1ccccc1 |c:8|
BDBM50371118 CCn1c2ccc(CC(O)=O)cc2c2cc(CC(O)=O)ccc12
BDBM50371119 OC(=O)c1ccc2NC(C3CC=CC3c2c1)c1cccnc1 |w:13.12,9.9,8.18,c:11|
BDBM50371120 OC(=O)c1ccc2NC(C3CC=CC3c2c1)c1cccc(Br)c1 |w:13.12,9.9,8.18,c:11|
BDBM50371121 OC(=O)c1ccc(cc1)-n1nc(c2CCCCc12)C(F)(F)F
BDBM50371122 OC(=O)CCC(=O)N1CCc2cc(ccc12)S(=O)(=O)NCc1cccs1
BDBM50371123 OC(=O)c1ccc2[nH]c3CCSCc3c2c1
BDBM50371124 Cn1c2ccccc2c2ccc(CC(O)=O)cc12
BDBM50371125 OC(=O)c1ccc2NC(C3CC=CC3c2c1)c1ccccc1C(F)(F)F |w:13.12,9.9,8.18,c:11|
BDBM50371126 OC(=O)Cc1ccc(cc1)C1C(=S)NC2C=CSC2C1=O |w:14.14,10.10,18.18,c:16|
BDBM50371127 OC(=O)c1ccc(cc1)-n1cccc1CC1=NC(=O)NC1=O |t:17|
BDBM50371128 OC(=O)c1ccc2NC(C3CC=CC3c2c1)c1ccccc1 |w:13.12,9.9,8.18,c:11|
BDBM50371129 OC(=O)c1ccc2[nH]c3CCCCc3c2c1
BDBM50371130 OC(=O)c1ccc(cc1)C1Nc2c(F)cc(F)cc2C2C=CCC12 |w:19.21,23.24,9.9,c:22|
BDBM50371131 OC(=O)Cc1ccc2c(c1)[nH]c1ccc(Br)cc21
BDBM50096253 OP(O)(=O)Cc1ccc(cc1)[N+]([O-])=O
BDBM50096252 OP(O)(=O)Cc1ccc(CCl)cc1