BindingDB logo
myBDB logout

12 SMILES Strings for Low-density lipoprotein receptor-related protein 6

Compound NameSMILES String
BDBM50135174 Cl.CN(C)c1ccc2nc3c(cc(=O)c(O)c3oc2c1)C(O)=O
BDBM50145410 CCCCOC(=O)c1c(NCc2ccc(OC)cc2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145377 COC(=O)c1c(N)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145378 COC(=O)c1c(Nc2ccccc2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145379 COC(=O)c1c(Nc2ccc(C)cc2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145380 COC(=O)c1c(Nc2ccc(OC)cc2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145382 COC(=O)c1c(NCc2ccc(OC)cc2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145383 COC(=O)c1c(N2CCCCC2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145384 COC(=O)c1c(NC2CCCCC2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145403 COC(=O)c1c(N2CCOCC2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145409 COC(=O)c1c(NC2CCCC2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C
BDBM50145381 COC(=O)c1c(Nc2ccc(Cl)c(Cl)c2)c(=O)c(O)c2oc3cc(ccc3nc12)N(C)C