BindingDB logo
myBDB logout

20 SMILES Strings for Luciferase

Compound NameSMILES String
BDBM50238208 COc1ccc(C(=O)Nc2ccc(C)cn2)c(OC)c1
BDBM50261867 O=C(Nc1ccc(cn1)-c1ccccc1)C1CCCCC1
BDBM50261868 Clc1ccc(cc1)-c1ccc(NC(=O)c2ccccc2)nc1
BDBM50261869 COc1ccc(cc1)-c1ccc(NC(=O)c2ccccc2)nc1
BDBM50261810 O=C(Nc1ccc2ccccc2n1)c1ccccc1
BDBM50261811 O=C(Nc1ccc(cn1)-c1ccccc1)c1ccccc1
BDBM50261812 Cc1ccc(NC(=O)c2ccccc2)nc1
BDBM50272796 Clc1cccc(c1)C(=O)Nc1ccc(cn1)-c1ccccc1
BDBM50272833 Nc1ccc(cc1)C(=O)Nc1ccc(cn1)-c1ccccc1
BDBM50352635 CC(C)Oc1cccc(c1)-c1ccnc(n1)N1CCC(CC1)C(N)=O
BDBM50352636 NC(=O)C1CCN(CC1)c1ncc(s1)-c1ccc2OCCCOc2c1
BDBM50352637 NC(=O)C1CCN(CC1)c1nnc(s1)-c1ccc2OCCCOc2c1
BDBM50352638 Cc1ccc(cc1)-c1cnc(s1)N1CCC(CC1)C(N)=O
BDBM50352639 CC(C)Oc1cccc(c1)-c1cnc(s1)N1CCC(CC1)C(N)=O
BDBM50352640 CSc1ccc(cc1)-c1cnc(s1)N1CCC(CC1)C(N)=O
BDBM50352641 OC(=O)C1CCN(CC1)c1ncc(s1)-c1ccc2OCCCOc2c1
BDBM50352642 O=C(Nc1ccccc1)C1CCN(CC1)c1ncc(s1)-c1ccc2OCCCOc2c1
BDBM50352634 OC(=O)C1CCN(CC1)c1nc(cs1)-c1ccc(Br)cc1
BDBM50357676 CNc1ccc(cc1)-c1nc2ccccc2c(=O)[nH]1
BDBM50370458 Nc1ncnc2n(cnc12)C1O[C@H](COS(=O)(=O)NC(=O)c2csc(n2)-c2nc3ccc(O)cc3s2)[C@@H](O)[C@H]1O |r|