BindingDB logo
myBDB logout

31 SMILES Strings for Lutropin-choriogonadotropic hormone receptor

Compound NameSMILES String
BDBM50189773 COc1cccc(c1F)-c1nc(SC)nc2sc(C(=O)NC(C)(C)C)c(N)c12
BDBM50189774 CSc1nc(-c2cccc(O)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C
BDBM50189775 COc1cccc(c1OC)-c1nc(SC)nc2sc(C(=O)NC(C)(C)C)c(N)c12
BDBM50189776 COc1cccc(c1)-c1nc(SC)nc2sc(C(=O)OC(C)(C)C)c(N)c12
BDBM50189777 CSc1nc(-c2cccc(F)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C
BDBM50189778 COc1cccc(c1)-c1nc(SC)nc2sc(C(=O)NC(C)(C)C)c(N)c12
BDBM50189779 COc1cccc(c1)-c1nc(SC)nc2sc(C(=O)N(C)C(C)(C)C)c(N)c12
BDBM50206401 CC(C)(C)c1ccc(cc1)-n1nc(cc1CCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)-c1cccnc1
BDBM50206402 CC(C)(C)c1ccc(cc1)-n1nc(cc1NCCCCCC(=O)N[C@@H](Cc1cccc(O)c1)C(N)=O)-c1ccccn1
BDBM50206403 CC(C)(C)Oc1ccc(C[C@H](NC(=O)CCCCNc2cc(nn2-c2ccc(cc2)C(C)(C)C)-c2cccnc2)C(N)=O)cc1
BDBM50206404 CC(C)(C)c1ccc(cc1)-n1nc(cc1NCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)-c1ccncc1
BDBM50206405 CC(C)(C)c1ccc(cc1)-n1nc(CCCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(N)=O)cc1-c1ccncc1
BDBM50206395 CC(C)(C)c1ccc(cc1)-n1nc(cc1CCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)-c1ccncc1
BDBM50206396 CC(C)(C)c1ccc(cc1)-n1nc(cc1CCC(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)-c1cccnc1
BDBM50206397 CC(C)(C)c1ccc(cc1)-n1nc(cc1CCCCC(=O)N[C@H](CC(N)=O)Cc1ccccc1)-c1ccncc1
BDBM50206398 CC(C)(C)c1ccc(cc1)-n1nc(cc1CCCCC(=O)NCCc1ccc(O)cc1)-c1cccnc1
BDBM50206399 CC(C)(C)c1ccc(cc1)-n1nc(cc1NCCCCCC(=O)N[C@H](C(N)=O)c1ccc(O)cc1)-c1ccccn1
BDBM50206400 CC(C)(C)c1ccc(cc1)-n1nc(cc1-c1cccc(c1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)-c1cc2ccccc2cn1
BDBM50256858 O=C(NC1CCCC1)Oc1cc(cc(c1)-c1ccccc1)-c1ccccc1
BDBM50335476 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCn4cc(COc5ccc(cc5)[C@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335477 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCn4cc(COc5ccc(cc5)[C@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335478 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCOCCn4cc(COc5ccc(cc5)[C@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335472 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCOCCn4cc(COc5ccc(cc5)[C@@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335473 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCN=[N+]=[N-])nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C
BDBM50335470 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCn4cc(COc5ccc(cc5)[C@@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335471 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCn4cc(COc5ccc(cc5)[C@@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335467 CSc1nc(-c2cccc(NCC(=O)NCC#C)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C
BDBM50335468 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCn4cc(COc5ccc(cc5)[C@@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335469 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCn4cc(COc5ccc(cc5)[C@@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335474 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCn4cc(COc5ccc(cc5)[C@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|
BDBM50335475 CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCn4cc(COc5ccc(cc5)[C@]5(C)CC(C)(C)N(C(C)=O)c6ccc(NC(=O)c7ccc(cc7)-c7ccccc7)cc56)nn4)nn3)c2)c2c(N)c(sc2n1)C(=O)NC(C)(C)C |r|