BindingDB logo
myBDB logout

7 SMILES Strings for LuxS

Compound NameSMILES String
BDBM65977 CCc1ccc(cc1)-c1ccc(C(O)=O)n1C=C
BDBM65978 CN(C)S(=O)(=O)c1ccc(NC(=S)NC(=O)Cc2ccccc2)cc1
BDBM65979 Cn1cnc(c1)S(=O)(=O)Nc1ccc(OC(F)(F)F)cc1
BDBM65980 CCc1ccc(cc1)S(=O)(=O)Nc1ccc(Br)cn1
BDBM65981 CCCc1ccc(cc1)S(=O)(=O)N(C)S(=O)(=O)c1ccc(F)cc1
BDBM65976 Cc1cccc(NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)n1
BDBM64221 COc1cc(NC(=O)CN2C(=O)NC(C2=O)(c2ccccc2)c2ccccc2)cc(OC)c1