BindingDB logo
myBDB logout

4 SMILES Strings for LynA/BTK

Compound NameSMILES String
BDBM194087 CC#CC(=O)N1CC[C@H](C1)n1c2ncnc(N)c2n(-c2ccc(Oc3ccccc3)cc2)c1=O |r|
BDBM275463 Nc1ncnc2n(C3CN(C3)C(=O)C=C)c(=O)n(-c3ccc(Oc4ccccc4)cc3)c12
BDBM275473 Nc1ncnc2n(CC3CCN(CC3)C(=O)C=C)c(=O)n(-c3ccc(Oc4ccccc4)cc3)c12
BDBM275489 CN(C)C\C=C\C(=O)N1CC[C@H](C1)n1c2ncnc(N)c2n(-c2ccc(Oc3ccccc3)cc2)c1=O