BindingDB logo
myBDB logout

7 SMILES Strings for Lysine-specific demethylase 3B (KDM3B)

Compound NameSMILES String
BDBM191598 CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(O)=O
BDBM60875 OC(=O)CCNc1cc(nc(n1)-c1ccccn1)N1CCc2ccccc2CC1
BDBM223320 CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(N)=O
BDBM195608 CC(C)c1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1
BDBM195609 CCc1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1C
BDBM50158857 CCN(CC)CCCCNCc1cc(C=O)ccn1
BDBM50158858 CCN(CCN(C)C)C(=O)CNCc1cc(CNC(=O)C(F)(F)F)ccn1