BindingDB logo
myBDB logout

4 SMILES Strings for Lysine-specific demethylase 4C (KDM4C)

Compound NameSMILES String
BDBM60875 OC(=O)CCNc1cc(nc(n1)-c1ccccn1)N1CCc2ccccc2CC1
BDBM195608 CC(C)c1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1
BDBM195609 CCc1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1C
BDBM195610 CCc1c(C)[nH]c2c(cnn2c1=O)C#N