BindingDB logo
myBDB logout

22 SMILES Strings for Lysine-specific demethylase 4D

Compound NameSMILES String
BDBM26113 OC(=O)c1ccnc(c1)C(O)=O
BDBM195612 O=c1[nH]c(Oc2cnn(Cc3ccccc3)c2)nc2cnccc12
BDBM50122002 Nc1cnccc1C(O)=O
BDBM50153318 OC(=O)c1ccncc1NCc1ccco1
BDBM50153321 Cc1ccsc1CNc1ncccc1C(O)=O
BDBM50151397 COc1cccc(CC(=O)Nc2ccc(O)c(c2)-c2cc(ccn2)C(O)=O)c1
BDBM50151393 Cc1cc(no1)C(=O)Nc1ccc(O)c(c1)-c1cc(ccn1)C(O)=O
BDBM50151392 OC(=O)c1ccnc(c1)-c1cc(NC(=O)c2ccc(O)cc2)ccc1O
BDBM50153322 OC(=O)c1ccncc1NCc1ccccc1
BDBM50149920 O=c1[nH]c(Oc2cnn(c2)C2CCCC2)nc2cnccc12
BDBM50149911 O=c1[nH]c(Oc2cnn(Cc3ccccc3)c2)nc2ncccc12
BDBM50149917 O=c1[nH]c(Oc2cnn(CC3CCCCC3)c2)nc2cnccc12
BDBM50149925 Oc1cc(Oc2nc3cnccc3c(=O)[nH]2)ccc1Cl
BDBM50153340 OC(=O)c1ccncc1NC(=O)CCc1ccccc1
BDBM50153341 OC(=O)c1ccncc1NC(=O)CCCc1ccccc1
BDBM50153344 OC(=O)c1ccncc1NC(=O)c1ccccc1
BDBM50151399 COCC(=O)Nc1ccc(O)c(c1)-c1cc(ccn1)C(O)=O
BDBM50151401 CC(=O)Nc1ccc(O)c(c1)-c1cc(ccn1)C(O)=O
BDBM50153319 Cc1ccsc1CNc1cnccc1C(O)=O
BDBM50153320 OC(=O)c1cccnc1NCc1ccco1
BDBM50149924 CC(C)c1ccc(Oc2nc3cnccc3c(=O)[nH]2)cn1
BDBM50153339 OC(=O)c1ccncc1NC(=O)Cc1ccccc1