BindingDB logo
myBDB logout

9 SMILES Strings for Lysine-specific demethylase 5A (KDM5A(1-739)ΔAP(2C-2S))

Compound NameSMILES String
BDBM50396019 OC(=O)c1ccnc(c1)-c1cc(ccn1)C(=O)NCCc1ccccc1
BDBM191600 Cc1cc(Cl)ccc1COc1ccnn1-c1cc(ccn1)C(O)=O
BDBM191603 COC(=O)c1ccnc(c1)-c1cc(ccn1)C(=O)NCCc1ccccc1
BDBM191601 OC(=O)c1ccncc1NC(=O)Cc1ccc(Cl)cc1
BDBM191602 Cn1cc(Nc2cnccc2C(O)=O)c2cccnc12
BDBM191596 CC(C)c1c(C)[nH]c2c(cnn2c1=O)C#N
BDBM191597 OC(=O)c1ccncc1Nc1nn(CCN2CCC(F)(F)CC2)c2ccc(F)cc12
BDBM191598 CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(O)=O
BDBM191599 CCOC(=O)c1ccnc(CNCC(=O)N(CC)CCN(C)C)c1