BindingDB logo
myBDB logout

5 SMILES Strings for Lysine-specific demethylase 5C (KDM5C)

Compound NameSMILES String
BDBM26106 OC(=O)CNC(=O)C(O)=O
BDBM26113 OC(=O)c1ccnc(c1)C(O)=O
BDBM191598 CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(O)=O
BDBM195612 O=c1[nH]c(Oc2cnn(Cc3ccccc3)c2)nc2cnccc12
BDBM60875 OC(=O)CCNc1cc(nc(n1)-c1ccccn1)N1CCc2ccccc2CC1