BindingDB logo
myBDB logout

8 SMILES Strings for Lysine-specific demethylase 6A

Compound NameSMILES String
BDBM191598 CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(O)=O
BDBM191599 CCOC(=O)c1ccnc(CNCC(=O)N(CC)CCN(C)C)c1
BDBM50158857 CCN(CC)CCCCNCc1cc(C=O)ccn1
BDBM50158858 CCN(CCN(C)C)C(=O)CNCc1cc(CNC(=O)C(F)(F)F)ccn1
BDBM50158859 CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(=O)OC
BDBM50158860 CCN1CCC[C@H](CNCc2cc(ccn2)C(O)=O)C1=O |r|
BDBM50158862 OC(=O)c1cnnc(CNCC(=O)N2CCCCC2)c1
BDBM50158861 OC(=O)c1ccnc(CNCc2nccn2C\C=C\c2ccccc2)c1