BindingDB logo
myBDB logout

20 SMILES Strings for Lysine-specific demethylase 6A (KDM6A)

Compound NameSMILES String
BDBM26113 OC(=O)c1ccnc(c1)C(O)=O
BDBM50395076 CN(C)NC(=O)CCC(O)=O
BDBM50440289 ON(CCC(O)=O)C(=O)CCCCCCCCC1CC1
BDBM50440290 CCCCCCCCCC(=O)N(O)CCC(O)=O
BDBM50440291 COC(=O)CCN(O)C(=O)CCCCCCCCC(C)C
BDBM50440292 CC(C)CCCCCCCCC(=O)N(O)CCC(O)=O
BDBM50440285 ON(CCC(O)=O)C(=O)CCCCCCCCc1ccccc1
BDBM50440286 ON(CCC(O)=O)C(=O)CCCCCCCCC1CCCCCC1
BDBM50440287 ON(CCC(O)=O)C(=O)CCCCCCCCC1CCCCC1
BDBM50440288 ON(CCC(O)=O)C(=O)CCCCCCCCC1CCCC1
BDBM60875 OC(=O)CCNc1cc(nc(n1)-c1ccccn1)N1CCc2ccccc2CC1
BDBM231631 CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)NCC(O)=O |r|
BDBM195608 CC(C)c1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1
BDBM195609 CCc1c([nH]c2c(cnn2c1=O)C#N)-c1ccccc1C
BDBM50155507 C[C@@H](N1CC[C@@H](CNCc2cc(ccn2)C(O)=O)C1=O)c1ccccc1 |r|
BDBM50155450 Cc1cn2CCN(Cc3cc(ccn3)C(O)=O)CCc2n1
BDBM50155508 C[C@@H](N1CCC[C@@H](CNCc2cc(ccn2)C(O)=O)C1=O)c1ccccc1 |r|
BDBM50155509 C[C@@H](N1CCC[C@H](CNCc2cc(ccn2)C(O)=O)C1=O)c1ccccc1 |r|
BDBM50155449 COc1ccc(cc1)[C@@H](C)N1CCC[C@@H](CNCc2cc(ccn2)C(O)=O)C1=O |r|
BDBM50155505 CCN1CCC(CNCc2cc(ccn2)C(O)=O)C1=O