BindingDB logo
myBDB logout

5 SMILES Strings for Lysine-specific histone demethylase 2 (LSD2)

Compound NameSMILES String
BDBM124968 NC1CC1c1ccc(NC(=O)C(Cc2ccccc2)NC(=O)COc2ccccc2)cc1
BDBM124969 NC1CC1c1ccc(NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)COc2ccccc2)cc1
BDBM50346864 NC1CC1c1ccc(NC(=O)C(Cc2ccccc2)NC(=O)OCc2ccccc2)cc1
BDBM50346586 NC1CC1c1ccc(NC(=O)OCc2ccccc2)cc1
BDBM50346863 NC1CC1c1ccc(NC(=O)c2ccccc2)cc1