BindingDB logo
myBDB logout

25 SMILES Strings for Lysophosphatidic acid receptor 1/lysophosphatidic acid receptor 3

Compound NameSMILES String
BDBM50170859 CC(OC(=O)Nc1c(C)noc1-c1ccc(CSCCC(O)=O)cc1)c1ccccc1Cl
BDBM50177328 CCCCCCC\C=C\CCCCCCCC[C@H]1OC[C@H](COP(O)([O-])=S)O1
BDBM50177329 CCCCCCCCc1ccc(CCCCCCC2OCC(COP(O)([O-])=O)O2)cc1
BDBM50177330 CCCCCCC\C=C\CCCCCCCC[C@H]1OC[C@@H](COP(O)([O-])=S)O1
BDBM50177331 CCCCCCCCCCCCC1OCC(COP(O)([O-])=O)O1
BDBM50177332 CCCCCCC\C=C\CCCCCCCCC1OCC(COP(O)([O-])=S)O1
BDBM50177333 CCCCCCC\C=C\CCCCCCCC[C@@H]1OC[C@@H](COP(O)([O-])=S)O1
BDBM50177334 CCCCCCCCc1ccc(CCCCCCC2OCC(COP(O)([O-])=S)O2)cc1
BDBM50177335 CCCCCCC\C=C\CCCCCCCC[C@@H]1OC[C@H](COP(O)([O-])=S)O1
BDBM50177336 CCCCCCC\C=C\CCCCCCCCC1OCC(COP(O)([O-])=O)O1
BDBM50177337 CCCCCCC\C=C\CCCCCCCC[C@H]1OC[C@@H](COP(O)([O-])=O)O1
BDBM50177338 C\C=C\C\C=C\C\C=C\CCCCCCCCC1OCC(COP(O)([O-])=O)O1
BDBM50177339 CCCCCCC\C=C\CCCCCCCC[C@@H]1OC[C@H](COP(O)([O-])=O)O1
BDBM50177340 CCCCCCC\C=C\CCCCCCCC[C@@H]1OC[C@@H](COP(O)([O-])=O)O1
BDBM50211645 CC(OC(=O)Nc1conc1-c1ccc(CSCCS(O)(=O)=O)cc1)c1ccccc1Cl
BDBM50211646 CC(OC(=O)Nc1conc1-c1ccc(CCCCC(O)=O)cc1)c1ccccc1Cl
BDBM50211647 CC(OC(=O)Nc1conc1-c1ccc(CSCCC(O)=O)cc1)C1=C(Cl)CCCC1 |c:26|
BDBM50211648 CC(OC(=O)Nc1conc1-c1ccc(CCSCC(O)=O)cc1)c1ccccc1Cl
BDBM50211649 CC(OC(=O)Nc1conc1-c1ccc(CSCCC(O)=O)cc1)c1ccccc1Cl
BDBM50211650 CC(OC(=O)Nc1conc1-c1ccc(CSCCC(O)=O)cc1)C1=C(Cl)CCC1 |c:26|
BDBM50211651 CC(OC(=O)Nc1cnoc1-c1ccc(CSCCC(O)=O)cc1)c1ccccc1Cl
BDBM50211652 CC(OC(=O)Nc1ccccc1-c1ccc(CSCCC(O)=O)cc1)c1ccccc1Cl
BDBM50211653 CC(OC(=O)Nc1conc1-c1ccc(CS(=O)(=O)CCC(O)=O)cc1)c1ccccc1Cl
BDBM50211654 CC(OC(=O)Nc1conc1-c1ccc(CCC(C)(C)CC(O)=O)cc1)c1ccccc1Cl
BDBM50211655 CC(OC(=O)Nc1conc1-c1ccc(NC(=O)CCC(O)=O)cc1)c1ccccc1Cl