BindingDB logo
myBDB logout

10 SMILES Strings for Lysophosphatidic acid receptor 4

Compound NameSMILES String
BDBM50148348 CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)COP(O)(O)=O
BDBM50381022 CCCCCCCCCCCCCCCCCC(=O)OCC(COP(O)(S)=O)OC
BDBM50430006 CCCCCCCCCCCCCCCCCCOC[C@H](COP(O)(O)=S)OC |r|
BDBM50430007 CCCCCCCCCCCCCCCCCC(=O)OC(COC)COP(O)([O-])=S
BDBM50430008 CCCCCCCCCCCCCCCCCOC(COC)COP(O)([O-])=S
BDBM50430009 CCCCCCCCCCCCCCCCOC(COC)COP(O)([O-])=S
BDBM50430010 CCCCCCCCCCCCCCCCCCOC[C@@H](COP(O)(O)=S)OC |r|
BDBM50430011 CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(O)=S)OC
BDBM50430012 CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](COP(O)(O)=S)OC
BDBM50430013 CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)COP(O)(O)=O