BindingDB logo
myBDB logout

15 SMILES Strings for Lysosomal alpha-mannosidase

Compound NameSMILES String
BDBM50163438 OC[C@@H]1NC[C@@H](O)[C@@H](O)[C@H]1O
BDBM50168995 O[C@@H]1CN2CCC[C@@H](O)[C@@H]2[C@@H]1O |r|
BDBM50168988 OC[C@H](NC[C@H]1NC[C@H](O)[C@@H]1O)c1ccccc1 |r|
BDBM50242271 OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |r|
BDBM50263047 O[C@H]1CN[C@H](CN[C@@H](COC(=O)c2ccc(Br)cc2)c2ccccc2)[C@H]1O |r|
BDBM50263048 OC[C@H](NC[C@H]1NC(=O)[C@H](O)[C@@H]1O)c1ccccc1 |r|
BDBM50263049 CN1[C@H](CN[C@@H](CO)c2ccccc2)[C@@H](O)[C@@H](O)C1=O |r|
BDBM50263050 O[C@@H]1[C@@H](CN[C@@H](COC(=O)c2ccc(Br)cc2)c2ccccc2)NC(=O)[C@@H]1O |r|
BDBM50263091 CN1[C@H](CN[C@@H](COC(=O)c2ccc(Br)cc2)c2ccccc2)[C@@H](O)[C@@H](O)C1=O |r|
BDBM50030339 OCCC1(O)[C@@H](O)CNC[C@H]1O |r|
BDBM50030340 CCCCN1C[C@H](O)C(O)(CCO)[C@H](O)C1 |r|
BDBM50030341 OCCN1C[C@H](O)C(O)(CCO)[C@H](O)C1 |r|
BDBM50030343 CCCCCCCCN1C[C@H](O)C(O)(CCO)[C@H](O)C1 |r|
BDBM50030374 CCCCCCCCCCN1C[C@H](O)C(O)(CCO)[C@H](O)C1 |r|
BDBM50030342 CCCCCCN1C[C@H](O)C(O)(CCO)[C@H](O)C1 |r|