BindingDB logo
myBDB logout

1 SMILES String for Lysosomal phospholipase A2

Compound NameSMILES String
BDBM50075320 CCCCCCCCCCP(O)(=O)OC(COCCCCCCCCCC(=O)OC)COP([O-])(=O)OCC[N+](C)(C)C