BindingDB logo
myBDB logout

3 SMILES Strings for Lysyl oxdiase (PPLO)

Compound NameSMILES String
BDBM185656 NCC#CCC(N)C(=O)NCCc1ccccc1