BindingDB logo
myBDB logout

5 SMILES Strings for Lysyl oxidase

Compound NameSMILES String
BDBM50122955 NC(=O)\C=C1/CCc2c1cc(F)cc2F
BDBM50161136 NCc1c(OCCO)cncc1OCCO
BDBM50161143 CCOc1cncc(OCC)c1CN
BDBM50161150 NCc1c(OCCCCO)cncc1OCCCCO
BDBM50161131 CCOc1cncc(OCc2ccccc2)c1CN