BindingDB logo
myBDB logout

60 SMILES Strings for Lysyl-tRNA synthetase

Compound NameSMILES String
BDBM50059889 CN[C@@H]1CC2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4CNC(=O)c4c4c5ccccc5n2c4c13
BDBM50126419 CN(C)c1ccc(cc1)-c1cc2ncccc2c(NCCCCN)n1
BDBM50249253 COc1cc(Nc2nc(NCCN)n3cnnc3c2C(N)=O)cc(OC)c1
BDBM50249254 COc1cc(Nc2nc(N[C@H]3CCCC[C@H]3N)n3cnnc3c2C(N)=O)cc(OC)c1 |r|
BDBM50249319 NCCNc1ncc(C(N)=O)c(Nc2cccc(c2)C(F)(F)F)n1
BDBM50249539 COc1cc(Nc2nc(N[C@H]3CCCC[C@H]3N)n3ncnc3c2C(N)=O)cc(OC)c1 |r|
BDBM50242740 CN1C(=O)N(Cc2cnc(N)nc12)c1cc(NC(=O)c2cccc(c2)C(F)(F)F)ccc1C
BDBM50242742 COc1cc(ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1)N1CCC(CC1)N1CCN(C)CC1
BDBM50263119 COc1cc(Nc2nc(N[C@H]3CCCC[C@H]3N)n3nc(nc3c2C(N)=O)-c2ccccc2)cc(OC)c1 |r|
BDBM50263120 COc1cccc(c1)-c1nc2c(C(N)=O)c(Nc3cc(OC)cc(OC)c3)nc(N[C@H]3CCCC[C@H]3N)n2n1 |r|
BDBM50263121 COc1cc(Nc2nc(N[C@H]3CCCC[C@H]3N)n3nc(nc3c2C(N)=O)-c2ccccc2Cl)cc(OC)c1 |r|
BDBM50263038 COc1cc(Nc2nc(NCCO)n3cnnc3c2C(N)=O)cc(OC)c1
BDBM50263039 COc1cc(Nc2nc(NCC(=O)OC(C)(C)C)n3cnnc3c2C(N)=O)cc(OC)c1
BDBM50263040 COc1cc(Nc2nc(NCC(C)(C)N)n3cnnc3c2C(N)=O)cc(OC)c1
BDBM50263076 COc1cc(Nc2nc(NCCCN)n3cnnc3c2C(N)=O)cc(OC)c1
BDBM50263077 COc1cc(Nc2nc(N[C@H]3CCCC[C@H]3N)n3c(nnc3c2C(N)=O)-c2ccccc2)cc(OC)c1 |r|
BDBM50297455 Cc1ccc2C(N=O)C(=O)N(Cc3cc(F)cc4COCOc34)c2c1
BDBM50306682 C[C@@H](Oc1cc(cnc1N)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl |r|
BDBM50320203 CC(C)COC(=O)Nc1ccc(cc1)-c1cnc2c(cnn2c1N)-c1ccc(cc1)N1CCN(C)CC1
BDBM50330261 CC(C)c1n[nH]c(Cl)c1-c1ccnc(Nc2ccc(cn2)N2CCC(CC2)N(C)C)n1
BDBM50330262 CC(C)c1[nH]nc(c1-c1ccnc(Nc2ccc(cn2)N2CCC(CC2)N(C)C)n1)C(F)(F)F
BDBM50355491 Nc1nc(Nc2ccc(cc2)[C@H]2CC[C@@H](CC2)N2CCOCC2)nn1-c1ccccn1 |r,wU:11.11,wD:14.18,(-9.05,.18,;-7.58,.64,;-7.09,2.1,;-5.55,2.08,;-4.8,3.43,;-3.26,3.44,;-2.48,2.12,;-.94,2.14,;-.18,3.48,;-.98,4.81,;-2.52,4.79,;1.35,3.5,;2.1,4.85,;3.65,4.86,;4.44,3.53,;3.68,2.19,;2.14,2.18,;5.97,3.55,;6.75,2.22,;8.29,2.23,;9.05,3.57,;8.27,4.9,;6.73,4.89,;-5.09,.62,;-6.35,-.28,;-6.36,-1.81,;-5.04,-2.59,;-5.05,-4.13,;-6.39,-4.89,;-7.72,-4.11,;-7.71,-2.57,)|
BDBM50390573 O=C(Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1)c1cncnc1
BDBM50390572 Cc1ccnc(Nc2cccc(n2)-c2cccnc2)c1
BDBM50390546 Cc1ccnc(Nc2cccc(n2)-c2cccc(N)c2)c1
BDBM50390547 Cc1ccnc(Nc2cccc(n2)-c2cccc(CN)c2)c1
BDBM50390548 Cc1ccnc(Nc2cccc(n2)-c2cccc(CCN)c2)c1
BDBM50390549 Cc1ccnc(Nc2cccc(n2)-c2ccnc(NCCN)c2)c1
BDBM50390550 Cc1ccnc(Nc2cccc(n2)-c2ccnc(NCCO)c2)c1
BDBM50390551 Cc1ccnc(Nc2cccc(n2)-c2ccnc(NCCCN)c2)c1
BDBM50390552 Cc1ccnc(Nc2cccc(n2)-c2ccnc(c2)N2CCNCC2)c1
BDBM50390553 Cc1ccnc(Nc2cccc(n2)-c2ccnc(c2)N2CCC(N)C2)c1
BDBM50390554 Cc1ccnc(Nc2cccc(n2)-c2ccnc(c2)N2CCC(N)CC2)c1
BDBM50390555 Cc1ccnc(Nc2cccc(n2)-c2ccnc(c2)N2CCCNCC2)c1
BDBM50390556 FC(F)(F)c1ccnc(Nc2cccc(n2)-c2ccnc(c2)N2CCNCC2)c1
BDBM50390557 FC(F)(F)c1ccnc(Nc2cccc(n2)-c2cccc(c2)N2CCNCC2)c1
BDBM50390558 C1CN(CCN1)c1cc(ccn1)-c1cccc(Nc2cnccn2)n1
BDBM50390559 C1CN(CCN1)c1cccc(c1)-c1cccc(Nc2cnccn2)n1
BDBM50390560 Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1
BDBM50390561 CNc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1
BDBM50390562 Oc1ccc(CNc2cc(Nc3cnccn3)nc(c2)-c2ccnc(c2)N2CCNCC2)cc1
BDBM50390563 O=C(Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1)C1CCNCC1
BDBM50390564 CC(=O)N1CCC(CC1)C(=O)Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1
BDBM50390565 O=C(Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1)c1ccccc1
BDBM50390566 O=C(Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1)c1cccnc1
BDBM50390567 Cc1cc(C(=O)Nc2cc(Nc3cnccn3)nc(c2)-c2ccnc(c2)N2CCNCC2)n(C)n1
BDBM50390568 O=C(Cc1cccnc1)Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1
BDBM50390569 OC(=O)c1ccc(cc1)C(=O)Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1
BDBM50390570 Cc1ccnc(Nc2cccc(n2)-c2cccc(NCCN)c2)c1
BDBM50390571 OC(=O)c1ccc(cn1)C(=O)Nc1cc(Nc2cnccn2)nc(c1)-c1ccnc(c1)N1CCNCC1
BDBM50387330 CC(C)C[C@H]1CN(CCN1)c1ccc(c(n1)C(=O)c1cccnc1N)C(F)(F)F |r|
BDBM50399676 CN1CCN(CC1)c1ccc(Nc2ncc3nc(Nc4ccccc4)n(C4CCCC4)c3n2)cc1
BDBM50426525 COc1ccc(Nc2nc(nc3scnc23)-c2cccc(CO)c2)cc1OC
BDBM50426526 COc1ccc(Nc2nc(nc3scnc23)N2CCC(C2)C(=O)Nc2ccc(cc2)C(O)=O)nc1OC
BDBM50426527 COc1ccc(Nc2nc(nc3scnc23)N2CCCC(C2)C(=O)Nc2ccc(C(O)=O)c(O)c2)cc1OC
BDBM50426528 COc1ccc(Nc2nc(nc3scnc23)N2CCCC(C2)C(=O)Nc2ccc(nc2)C(O)=O)cc1OC
BDBM50426529 COc1ccc(Nc2nc(nc3scnc23)N2CCCC(C2)C(=O)NCCc2ccncc2)cc1OC
BDBM50426530 CNC(=O)c1ccc(NC(=O)c2cccc(c2)-c2nc(Nc3ccc(OC)c(OC)c3)c3ncsc3n2)cc1
BDBM50434379 C[C@H]1CCC[C@H](C[C@H]2Cc3cc(O)cc(O)c3C(=O)O2)O1 |r|
BDBM50208911 CC1(C)C(=O)N([C@H]2CCc3c2cccc3O)c2nc(Nc3ccccc3)ncc12 |r|