BindingDB logo
myBDB logout

2 SMILES Strings for M3 muscarinic receptor (M3'(3C)-Xa F550C)

Compound NameSMILES String
BDBM50004656 C[N+](C)(C)CCOC(N)=O
BDBM214800 C[N+]1(C)[C@H]2CC(C[C@@H]1[C@H]1O[C@@H]21)OC(=O)[C@H](CO)c1ccccc1