BindingDB logo
myBDB logout

5 SMILES Strings for MAP Kinase p38 alpha

Compound NameSMILES String
BDBM14831 Cn1nc(cc1NC(=O)Nc1ccc(Cl)cc1)C(C)(C)C
BDBM14834 Cc1ccc(cc1)-n1nc(cc1NC(=O)Nc1ccc(OCCN2CCOCC2)c2ccccc12)C(C)(C)CO
BDBM14835 Cn1nc(cc1NC(=O)Nc1ccc(OCCN2CCOCC2)c2ccccc12)C(C)(C)C
BDBM14836 Cc1ccc(cc1)-n1nc(cc1NC(=O)Nc1ccccc1)C(C)(C)C
BDBM14842 O=C(Nc1ccnn1-c1ccccc1)Nc1ccc(OCCN2CCOCC2)c2ccccc12