BindingDB logo
myBDB logout

1 SMILES String for MAP-Microtubule Affinity-Regulating Kinase 3 (MARK3)

Compound NameSMILES String
BDBM25017 CC(C)CCN1C(C)C(=O)N(C)c2cnc(Nc3cc(F)c(O)c(F)c3)nc12