BindingDB logo
myBDB logout

1 SMILES String for MAP3K5

Compound NameSMILES String
BDBM31096 CN[C@H]1C[C@@H]2O[C@](C)([C@H]1OC)n1c3ccccc3c3c4CNC(=O)c4c4c5ccccc5n2c4c13