BindingDB logo
myBDB logout

2 SMILES Strings for MAT2A

Compound NameSMILES String
BDBM102424 CN(C)c1ccc(\C=C\c2c(F)cccc2F)cc1
BDBM102425 CNc1ccc(\C=C\c2c(F)cccc2Cl)cc1