BindingDB logo
myBDB logout

1 SMILES String for MCG3105, isoform CRA_a

Compound NameSMILES String
BDBM50044849 COc1ccc(cc1)S(=O)(=O)Nc1c(C)cc(C)cc1C