BindingDB logo
myBDB logout

18 SMILES Strings for MEP2

Compound NameSMILES String
BDBM33150 Cc1ccc(\C=C\C(=O)c2ccccc(=O)c2O)c(C)c1
BDBM34183 CCOC(=O)CS(=O)(=O)c1nc(cc(n1)C(F)(F)F)-c1ccccc1
BDBM33111 CNC(CC(=O)c1ccc(cc1)[N+]([O-])=O)C(Cl)(Cl)Cl
BDBM32147 Oc1c(Cl)cc(Cl)c2cccnc12
BDBM32188 Oc1c(I)cc(Cl)c2cccnc12
BDBM44460 Nc1ccc(Br)c2C(=O)c3ccccc3C(=O)c12
BDBM50864 CCCCNc1c2-c3ccccc3C(=O)c3cccc(n(C)c1=O)c23
BDBM55139 Fc1ccc(cc1)-c1nn(cc1C=c1c(=C)[nH][nH]c1=O)-c1ccccc1 |w:12.13|
BDBM57870 CCN1\C(Sc2ccc3sccc3c12)=C\c1ccc2cc(C)ccc2[n+]1CC
BDBM61009 C[C@]12C[C@@]1(C=O)C(C=O)=C[C@@H]1CC(C)(C)C[C@H]21 |c:9|
BDBM66018 Clc1ccc(cc1)-c1ccc(\[#6]=[#6]-2\[#6](=O)-[#7]-[#6](=O)-[#7]-[#6]-2=O)o1
BDBM66023 CCCCCCCCn1sccc1=O
BDBM66024 Clc1ccc2c(OC(=O)N3CCCCCC3)ccnc2c1
BDBM65993 CCOC(=O)COc1ccc2ccccc2c1\C=C\[N+]([O-])=O
BDBM66003 Fc1ccc(CN2C(=O)NC(=O)\C(=C/c3cccs3)C2=O)cc1
BDBM66010 CNc1nc(N)c(c(Nc2cccc(F)c2)n1)[N+]([O-])=O
BDBM76301 Oc1c(Br)cc(Br)c2cccnc12
BDBM76252 Nc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1[N+]([O-])=O