BindingDB logo
myBDB logout

3 SMILES Strings for MERS-CoV papain-like protease (MERS-PLpro)

Compound NameSMILES String
BDBM154573 Nc1ncnc2[nH]c(nc12)C(F)(F)F
BDBM154575 CCOc1cccc2cc(oc12)-c1nnc(NC(=O)c2sc3ccccc3c2Cl)o1
BDBM50007789 C[C@@H](N1CCC(CC1)C(=O)NCc1ccc2OCOc2c1)c1cccc2ccccc12 |r|