BindingDB logo
myBDB logout

5 SMILES Strings for MRCK alpha

Compound NameSMILES String
BDBM25470 O=C(Nc1nc(cs1)-c1ccncc1)C1COc2ccccc2O1
BDBM25471 O=C(Nc1ccc(cc1)-c1ccncc1)C1COc2ccccc2O1
BDBM25472 O=C(Nc1ccc(cc1)-c1cn[nH]c1)C1COc2ccccc2O1
BDBM25473 COc1cc(ccc1NC(=O)C1COc2ccccc2O1)-c1cn[nH]c1
BDBM25474 CN(C)CCOc1cc(ccc1NC(=O)C1COc2ccccc2O1)-c1cn[nH]c1