BindingDB logo
myBDB logout

3 SMILES Strings for Macrophage colony stimulating factor receptor

Compound NameSMILES String
BDBM276741 CC1(C)CCC(=CC1)c1nc(ccc1NC(=O)c1nc(c[nH]1)C#N)C1CC(C)(C)OC(C)(C1)C(O)=O |c:5|
BDBM276742 CC1(C)CCC(=CC1)c1nc(ccc1NC(=O)c1nc(c[nH]1)C#N)C1CC(C)(C)OC(C)(CO)C1 |c:5|
BDBM276743 CC1(C)CCC(=CC1)c1nc(ccc1NC(=O)c1nc(c[nH]1)C#N)C1CC(C)(C)OC(C)(C)C1 |c:5|