BindingDB logo
myBDB logout

14 SMILES Strings for Macrophage colony-stimulating factor 1 (CSF-1)

Compound NameSMILES String
BDBM97729 O=C(Nc1ccc(cc1C1=CCCCC1)C1CNS(=O)(=O)NC1)c1nc(c[nH]1)C#N |t:10|
BDBM97730 OCc1cc(NC(=O)c2nc(c[nH]2)C#N)c(cc1C1CNS(=O)(=O)NC1)C1=CCCCC1 |t:29|
BDBM97735 O=C(Nc1ccc(cc1C1=CCCCC1)C1CNC(NC1)=NC#N)c1nc(c[nH]1)C#N |t:10,(6.88,1.32,;5.55,.55,;4.22,1.32,;2.88,.55,;2.88,-.99,;1.55,-1.76,;.22,-.99,;.22,.55,;1.55,1.32,;1.55,2.86,;2.88,3.63,;2.88,5.17,;1.55,5.94,;.22,5.17,;.22,3.63,;-1.12,-1.76,;-1.12,-3.3,;-2.45,-4.07,;-3.78,-3.3,;-3.78,-1.76,;-2.45,-.99,;-5.12,-4.07,;-6.45,-3.3,;-7.79,-2.53,;6.32,-.78,;5.42,-2.03,;6.32,-3.27,;7.79,-2.8,;7.79,-1.26,;5.55,-4.61,;4.78,-5.94,)|
BDBM97732 CN1CC(CN(C)C1=O)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCC(C)(C)CC1 |t:28|
BDBM97738 O=C(Nc1ccc(cc1C1=CCCCC1)C1COC(=O)OC1)c1nc(c[nH]1)C#N |t:10|
BDBM97731 CN1CC(CN(C)C1=O)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCCCC1 |t:28|
BDBM97734 CN1CC(CN(C)S1(=O)=O)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCCCC1 |t:29|
BDBM97727 O=C(Nc1ccc(cc1C1=CCCCC1)C1CC(=O)NC(=O)C1)c1nc(c[nH]1)C#N |t:10|
BDBM97737 CN1C(=O)CC(CC1=O)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCCCC1 |t:28|
BDBM97726 O=C(Nc1ccc(cc1C1=CCCCC1)C1CNC(=O)NC1)c1nc(c[nH]1)C#N |t:10|
BDBM97728 CC1(C)CCC(=CC1)c1cc(ccc1NC(=O)c1nc(c[nH]1)C#N)C1CC(=O)NC(=O)C1 |c:5|
BDBM97733 CN1CC(CN(C)C1=O)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCCCCC1 |t:28|
BDBM97736 CS(=O)(=O)N=C1NCC(CN1)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCCCC1 |t:30,(-7.73,-4.07,;-6.4,-3.3,;-6.4,-1.76,;-6.4,-4.84,;-5.07,-4.07,;-3.73,-3.3,;-2.4,-4.07,;-1.07,-3.3,;-1.07,-1.76,;-2.4,-.99,;-3.73,-1.76,;.27,-.99,;1.6,-1.76,;2.94,-.99,;2.94,.55,;4.27,1.32,;5.6,.55,;6.94,1.32,;6.37,-.78,;5.47,-2.03,;6.37,-3.27,;7.84,-2.8,;7.84,-1.26,;5.6,-4.61,;4.83,-5.94,;1.6,1.32,;.27,.55,;1.6,2.86,;2.94,3.63,;2.94,5.17,;1.6,5.94,;.27,5.17,;.27,3.63,)|
BDBM97739 CN1CC(CN(C)C1=NC#N)c1ccc(NC(=O)c2nc(c[nH]2)C#N)c(c1)C1=CCC(C)(C)CC1 |t:30,(-8.73,-1.92,;-7.39,-2.69,;-6.06,-1.93,;-4.73,-2.69,;-4.73,-4.23,;-6.06,-5,;-6.06,-6.54,;-7.39,-4.23,;-8.73,-5,;-8.73,-6.54,;-8.73,-8.08,;-3.39,-1.93,;-2.06,-2.69,;-.72,-1.93,;-.72,-.38,;.61,.38,;1.94,-.38,;1.94,-1.93,;3.28,.38,;3.28,1.93,;4.74,2.4,;5.65,1.15,;4.74,-.09,;5.51,3.73,;6.28,5.07,;-2.06,.38,;-3.39,-.38,;-2.06,1.93,;-.72,2.69,;-.72,4.23,;-2.06,5,;-3.15,6.09,;-.72,5.77,;-3.39,4.23,;-3.39,2.69,)|