BindingDB logo
myBDB logout

2 SMILES Strings for Macrophage mannose receptor 1

Compound NameSMILES String
BDBM50399360 OC[C@H]1O[C@H](Oc2ccc(cc2Cl)-c2ccc(cc2)C(O)=O)[C@@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50399361 OC[C@H]1O[C@H](Oc2ccc(cc2Cl)-n2ccc3cc(ccc23)C(O)=O)[C@@H](O)[C@@H](O)[C@@H]1O |r|