BindingDB logo
myBDB logout

2 SMILES Strings for Macrophage metalloelastase

Compound NameSMILES String
BDBM50295479 CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(cc21)N1CCOC1=O)C(O)=O |r|
BDBM50360969 CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(cc21)-c1nccs1)C(O)=O |r|