BindingDB logo
myBDB logout

2 SMILES Strings for Macrophage-stimulating protein receptor (RON)

Compound NameSMILES String
BDBM213708 Fc1cc(NC(=O)c2cnn(c2C(F)(F)F)-c2ccccc2)ccc1Oc1ccnc2NC(=O)NCc12
BDBM213709 Cc1c(cnn1-c1ccccc1)C(=O)Nc1ccc(Oc2ccnc3NC(=O)NCc23)c(F)c1