BindingDB logo
myBDB logout

20 SMILES Strings for Malate dehydrogenase

Compound NameSMILES String
BDBM2581 O=C1NCc2c1c1c3ccccc3[nH]c1c1[nH]c3ccccc3c21
BDBM2681 CN(C)CCCn1cc(C2=C(C(=O)NC2=O)c2cn(C)c3ccccc23)c2ccccc12 |t:9|
BDBM3175 Cn1cc(C2=C(C(=O)NC2=O)c2cn(CCCSC(N)=N)c3ccccc23)c2ccccc12 |t:4|
BDBM7460 Oc1cc(O)c2c(c1)oc(-c1ccc(O)c(O)c1)c(O)c2=O
BDBM59100 Cc1ccc(Oc2ccc(NC(=O)CN3C(=S)S\C(=C/c4ccc(O)c(O)c4)C3=O)cc2)cc1
BDBM50072147 Nc1ccccc1SC(=N)C(C#N)C(C#N)C(=N)Sc1ccccc1N
BDBM50111585 Oc1ccc(cc1)N=Nc1ccc(Br)cc1 |w:8.9|
BDBM50111589 [#8-]-[#6](=O)-c1ccccc1\[#6](=[#6]-1\[#6]=[#6](I)-[#6](=O)-[#6](I)=[#6]-1)-c1cc(I)c(-[#8-])c(I)c1 |c:18,t:12|
BDBM50111591 Oc1ccc(cc1O)-c1csc(Nc2ccc(F)cc2F)n1
BDBM50111604 Oc1oc(\C=N\c2ccc(Oc3ccccc3)cc2)c2ccccc12
BDBM50126827 Oc1c(ccc2ccccc12)N=Nc1ccc(c2ccccc12)S([O-])(=O)=O |w:11.12|
BDBM50126829 CC(=O)c1c(O)c(C)c(O)c(Cc2c(O)c3C=CC(C)(C)Oc3c(C(=O)C=Cc3ccccc3)c2O)c1O |w:26.26,c:16|
BDBM50023867 Oc1[nH]c2ccccc2c1C1=Nc2ccccc2C1=O |t:12|
BDBM50310357 O=C1C(Nc2ccccc12)=C1Nc2ccccc2C1=O |w:2.2|
BDBM50044967 Oc1ccc(\C=C2/SC(=S)N(CC(=O)Nc3ccc(Oc4ccc(Cl)cc4)cc3)C2=O)cc1O
BDBM50044971 Cc1ccc(Oc2ccc(NC(=O)CN3C(=S)S\C(=C/c4cccc(O)c4O)C3=O)cc2)cc1
BDBM50044974 Oc1ccc(\C=C2/SC(=S)N(CC(=O)Nc3ccc(Oc4ccc(Cl)cc4)cc3)C2=O)c(O)c1
BDBM50044975 ONC(=O)CN1C(=S)S\C(=C/c2ccc(O)c(O)c2)C1=O
BDBM50044976 OC(=O)CN1C(=S)S\C(=C/c2ccc(O)c(O)c2)C1=O
BDBM50044973 Oc1cccc(\C=C2/SC(=S)N(CC(=O)Nc3ccc(Oc4ccc(Cl)cc4)cc3)C2=O)c1O