BindingDB logo
myBDB logout

11 SMILES Strings for Malonyl-CoA decarboxylase, mitochondrial

Compound NameSMILES String
BDBM50328213 OC(c1cnc(s1)N1CCN(CC1)c1ccc(F)c(F)c1)(C(F)(F)F)C(F)(F)F
BDBM50328225 NC(=O)c1cccc(c1)N1CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F
BDBM50328227 CNC(=O)c1cccc(c1)N1CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F
BDBM50328230 OC(c1cnc(s1)C1CCN(CC1)c1ccc(F)cc1)(C(F)(F)F)C(F)(F)F
BDBM50328231 NC(=O)c1cccc(c1)N1CCC(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F
BDBM50328235 OC(=O)c1cccc(c1)C1CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F
BDBM50328237 NC(=O)c1cccc(c1)C1CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F
BDBM50328242 NC(=O)C1(CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F)c1ccccc1
BDBM50328243 CNC(=O)C1(CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F)c1ccccc1
BDBM50328246 NC(=O)C1(CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F)c1cccc(c1)C(O)=O
BDBM50328248 CS(=O)(=O)NC(=O)C1(CCN(CC1)c1ncc(s1)C(O)(C(F)(F)F)C(F)(F)F)c1ccccc1