BindingDB logo
myBDB logout

2 SMILES Strings for Mandelate racemase

Compound NameSMILES String
BDBM50129059 OP([O-])(=O)[C@@H](F)c1ccccc1
BDBM50129061 OP(O)([O-])C(=O)c1ccccc1